Information card for entry 2241897
| Chemical name |
1,2-Bis(6-bromo-3,4-dihydro-2<i>H</i>-benz[<i>e</i>][1,3]oxazin-3-yl)ethane |
| Formula |
C18 H18 Br2 N2 O2 |
| Calculated formula |
C18 H18 Br2 N2 O2 |
| SMILES |
Brc1cc2c(cc1)OCN(CCN1COc3c(C1)cc(cc3)Br)C2 |
| Title of publication |
Crystal structure of 1,2-bis(6-bromo-3,4-dihydro-2<i>H</i>-benz[<i>e</i>][1,3]oxazin-3-yl)ethane: a bromine-containing bis-benzoxazine |
| Authors of publication |
Rivera, Augusto; Rojas, Jicli José'; Ríos-Motta, Jaime; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2016 |
| Journal volume |
72 |
| Journal issue |
11 |
| Pages of publication |
1645 - 1647 |
| a |
19.464 ± 0.002 Å |
| b |
5.9444 ± 0.0007 Å |
| c |
17.2225 ± 0.0019 Å |
| α |
90° |
| β |
121.557 ± 0.007° |
| γ |
90° |
| Cell volume |
1698 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0626 |
| Residual factor for significantly intense reflections |
0.0563 |
| Weighted residual factors for significantly intense reflections |
0.1386 |
| Weighted residual factors for all reflections included in the refinement |
0.1428 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241897.html