Information card for entry 2241933
| Common name |
(18-Crown-6)potassium acetate dihydrate |
| Chemical name |
(Acetato-κ^2^<i>O</i>,<i>O</i>')(1,4,7,10,13,16-hexaoxacyclooctadecane-\ κ^6^<i>O</i>)potassium dihydrate |
| Formula |
C14 H31 K O10 |
| Calculated formula |
C14 H31 K O10 |
| SMILES |
C1C[O]2CC[O]3CC[O]4CC[O]5CC[O]6CC[O]1[K]123456OC(=[O]1)C.O.O |
| Title of publication |
Crystal structures of two solvates of (18-crown-6)potassium acetate |
| Authors of publication |
Liebing, Phil; Zaeni, Ahmad; Olbrich, Falk; Edelmann, Frank T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2016 |
| Journal volume |
72 |
| Journal issue |
12 |
| Pages of publication |
1757 - 1761 |
| a |
11.683 ± 0.002 Å |
| b |
8.594 ± 0.002 Å |
| c |
20.083 ± 0.004 Å |
| α |
90° |
| β |
100.59 ± 0.03° |
| γ |
90° |
| Cell volume |
1982.1 ± 0.7 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0386 |
| Residual factor for significantly intense reflections |
0.0305 |
| Weighted residual factors for significantly intense reflections |
0.0753 |
| Weighted residual factors for all reflections included in the refinement |
0.0795 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241933.html