Information card for entry 2242083
| Chemical name |
1-(4-Chlorophenyl)-2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethanone |
| Formula |
C16 H10 Cl2 N2 O2 S |
| Calculated formula |
C16 H10 Cl2 N2 O2 S |
| SMILES |
Clc1ccc(cc1)C(=O)CSc1oc(nn1)c1ccc(Cl)cc1 |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of 1-(4-chlorophenyl)-2-{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethanone |
| Authors of publication |
Kumar, Rajesh; Hussain, Shafqat; Khan, Khalid M.; Perveen, Shahnaz; Yousuf, Sammer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
4 |
| Pages of publication |
524 - 527 |
| a |
19.1513 ± 0.0007 Å |
| b |
11.1589 ± 0.0004 Å |
| c |
7.5071 ± 0.0003 Å |
| α |
90° |
| β |
92.088 ± 0.001° |
| γ |
90° |
| Cell volume |
1603.26 ± 0.1 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0579 |
| Residual factor for significantly intense reflections |
0.0452 |
| Weighted residual factors for significantly intense reflections |
0.1165 |
| Weighted residual factors for all reflections included in the refinement |
0.132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.118 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242083.html