Information card for entry 2242089
| Chemical name |
4,4'-Dinitro-[1,1'-biphenyl]-2-amine |
| Formula |
C12 H9 N3 O4 |
| Calculated formula |
C12 H9 N3 O4 |
| SMILES |
O=N(=O)c1cc(N)c(c2ccc(N(=O)=O)cc2)cc1 |
| Title of publication |
Crystal structure of 4,4'-dinitro-[1,1'-biphenyl]-2-amine |
| Authors of publication |
Faizi, Md. Serajul Haque; Haque, Ashanul; Dege, Necmi; Hasan, Syed Imran; Dege, Mustafa; Kalibabchuk, Valentina A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
4 |
| Pages of publication |
550 - 552 |
| a |
14.294 ± 0.0011 Å |
| b |
7.0352 ± 0.0006 Å |
| c |
11.6043 ± 0.0009 Å |
| α |
90° |
| β |
99.437 ± 0.006° |
| γ |
90° |
| Cell volume |
1151.15 ± 0.16 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1314 |
| Residual factor for significantly intense reflections |
0.0398 |
| Weighted residual factors for significantly intense reflections |
0.0725 |
| Weighted residual factors for all reflections included in the refinement |
0.0924 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.812 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242089.html