Information card for entry 2242162
| Chemical name |
1-(4-Bromophenyl)-2-{[5-(3-pyridinyl)-1,3,4-oxadiazol-2-yl]sulfanyl}- 1-ethanone |
| Formula |
C15 H10 Br N3 O2 S |
| Calculated formula |
C15 H10 Br N3 O2 S |
| SMILES |
Brc1ccc(cc1)C(=O)CSc1oc(nn1)c1cccnc1 |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of 1-(4-bromophenyl)-2-{[5-(pyridin-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}ethan-1-one |
| Authors of publication |
Bano, Huma; Hussain, Shafqat; Khan, Khalid M.; Perveen, Shahnaz; Yousuf, Sammer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
4 |
| Pages of publication |
623 - 626 |
| a |
11.9144 ± 0.0016 Å |
| b |
8.3755 ± 0.0012 Å |
| c |
30.382 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3031.8 ± 0.7 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.053 |
| Residual factor for significantly intense reflections |
0.0354 |
| Weighted residual factors for significantly intense reflections |
0.093 |
| Weighted residual factors for all reflections included in the refinement |
0.1139 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.133 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242162.html