Information card for entry 2242549
| Common name |
(2R,3R)-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylic acid |
| Chemical name |
(2<i>R</i>,3<i>R</i>)-1,4-Dioxaspiro[4.5]decane-2,3-dicarboxylic acid |
| Formula |
C10 H14 O6 |
| Calculated formula |
C10 H14 O6 |
| SMILES |
OC(=O)[C@@H]1OC2(O[C@H]1C(=O)O)CCCCC2 |
| Title of publication |
(2<i>R</i>,3<i>R</i>)-1,4-Dioxaspiro[4.4]nonane-2,3-dicarboxylic and (2<i>R</i>,3<i>R</i>)-1,4-dioxaspiro[4.5]decane-2,3-dicarboxylic acids |
| Authors of publication |
Minyaev, Mikhail E.; Roitershtein, Dmitrii M.; Vinogradov, Alexey A.; Ananyev, Ivan V.; Nifant'ev, Ilya E. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2018 |
| Journal volume |
74 |
| Journal issue |
8 |
| Pages of publication |
1058 - 1062 |
| a |
6.4272 ± 0.0008 Å |
| b |
5.2976 ± 0.0006 Å |
| c |
15.5678 ± 0.0019 Å |
| α |
90° |
| β |
94.469 ± 0.002° |
| γ |
90° |
| Cell volume |
528.45 ± 0.11 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0293 |
| Residual factor for significantly intense reflections |
0.0276 |
| Weighted residual factors for significantly intense reflections |
0.0703 |
| Weighted residual factors for all reflections included in the refinement |
0.0717 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242549.html