Information card for entry 2242616
| Common name |
Trimethyl citrate |
| Chemical name |
Trimethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| Formula |
C9 H14 O7 |
| Calculated formula |
C9 H14 O7 |
| SMILES |
COC(=O)CC(CC(=O)OC)(C(=O)OC)O |
| Title of publication |
Inversion dimers dominate the crystal packing in the structure of trimethyl citrate (trimethyl 2-hydroxypropane-1,2,3-tricarboxylate) |
| Authors of publication |
Morjan, Rami Y.; El-Kurdi, Said M.; Azarah, Jannat N.; Eleiwa, Neda A.; Abu-Teim, Omar S.; Awadallah, Adel M.; Raftery, James; Gardiner, John M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2018 |
| Journal volume |
74 |
| Journal issue |
9 |
| Pages of publication |
1362 - 1365 |
| a |
7.8428 ± 0.0003 Å |
| b |
8.0256 ± 0.0003 Å |
| c |
9.3965 ± 0.0003 Å |
| α |
109.915 ± 0.001° |
| β |
92.832 ± 0.001° |
| γ |
104.493 ± 0.001° |
| Cell volume |
532.46 ± 0.03 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0401 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.1034 |
| Weighted residual factors for all reflections included in the refinement |
0.1099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242616.html