Information card for entry 2242945
| Common name |
1,3-diphenyl-6-mesitylfulvene |
| Chemical name |
{3-[(2,4,6-Trimethylphenyl)methylidene]-4-phenylcyclopenta-1,4-dien-1-yl}benzene |
| Formula |
C27 H24 |
| Calculated formula |
C27 H24 |
| SMILES |
C1(=CC(=C/C1=C\c1c(cc(cc1C)C)C)c1ccccc1)c1ccccc1 |
| Title of publication |
Crystal structures of a series of 6-aryl-1,3-diphenylfulvenes |
| Authors of publication |
Peloquin, Andrew J.; Adas, Sonya K.; Iacono, Scott T.; Balaich, Gary J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
6 |
| Pages of publication |
838 - 842 |
| a |
30.031 ± 0.006 Å |
| b |
5.6147 ± 0.0012 Å |
| c |
23.494 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3961.4 ± 1.4 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
2 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0567 |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1083 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242945.html