Information card for entry 2242978
| Chemical name |
enzyl 1-benzyl-2-oxo-1,2-dihydroquinoline-4-carboxylate |
| Formula |
C24 H19 N O3 |
| Calculated formula |
C24 H19 N O3 |
| SMILES |
O(Cc1ccccc1)C(=O)c1c2ccccc2n(c(=O)c1)Cc1ccccc1 |
| Title of publication |
Crystal structure and DFT study of benzyl 1-benzyl-2-oxo-1,2-dihydroquinoline-4-carboxylate |
| Authors of publication |
Bouzian, Younos; Faizi, Md. Serajul Haque; Mague, Joel T.; Otmani, Bouchaib El; Dege, Necmi; Karrouchi, Khalid; Essassi, El Mokhtar |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
7 |
| Pages of publication |
980 - 983 |
| a |
5.6101 ± 0.0004 Å |
| b |
19.5523 ± 0.0011 Å |
| c |
17.2761 ± 0.0011 Å |
| α |
90° |
| β |
96.969 ± 0.005° |
| γ |
90° |
| Cell volume |
1881 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0759 |
| Residual factor for significantly intense reflections |
0.041 |
| Weighted residual factors for significantly intense reflections |
0.1034 |
| Weighted residual factors for all reflections included in the refinement |
0.1145 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.954 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2242978.html