Information card for entry 2243179
| Chemical name |
(<i>E</i>)-6-(4-Hydroxy-3-methoxystyryl)-4,5-dihydropyridazin-3(2<i>H</i>)-\ one |
| Formula |
C13 H14 N2 O3 |
| Calculated formula |
C13 H14 N2 O3 |
| SMILES |
O=C1NN=C(/C=C/c2cc(OC)c(O)cc2)CC1 |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of (<i>E</i>)-6-(4-hydroxy-3-methoxystyryl)-4,5-dihydropyridazin-3(2<i>H</i>)-one |
| Authors of publication |
Daoui, Said; Baydere, Cemile; El Kalai, Fouad; Saddik, Rafik; Dege, Necmi; Karrouchi, Khalid; Benchat, Noureddine |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
11 |
| Pages of publication |
1734 - 1737 |
| a |
6.0828 ± 0.0009 Å |
| b |
9.4246 ± 0.0013 Å |
| c |
11.1724 ± 0.0016 Å |
| α |
75.838 ± 0.011° |
| β |
83.099 ± 0.012° |
| γ |
84.059 ± 0.011° |
| Cell volume |
614.7 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.097 |
| Residual factor for significantly intense reflections |
0.0558 |
| Weighted residual factors for significantly intense reflections |
0.1271 |
| Weighted residual factors for all reflections included in the refinement |
0.1472 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243179.html
