Information card for entry 2243360
| Chemical name |
2-[(2,4,6-Trimethylbenzene)sulfonyl]phthalazin-1(2<i>H</i>)-one |
| Formula |
C17 H16 N2 O3 S |
| Calculated formula |
C17 H16 N2 O3 S |
| SMILES |
S(=O)(=O)(n1ncc2c(c1=O)cccc2)c1c(cc(cc1C)C)C |
| Title of publication |
2-[(2,4,6-Trimethylbenzene)sulfonyl]phthalazin-1(2<i>H</i>)-one: crystal structure, Hirshfeld surface analysis and computational study |
| Authors of publication |
Izuogu, David Chukwuma; Asegbeloyin, Jonnie Niyi; Jotani, Mukesh M.; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
5 |
| Pages of publication |
697 - 702 |
| a |
7.9782 ± 0.0004 Å |
| b |
8.1711 ± 0.0005 Å |
| c |
12.6661 ± 0.0007 Å |
| α |
92.214 ± 0.002° |
| β |
93.423 ± 0.001° |
| γ |
114.274 ± 0.001° |
| Cell volume |
749.55 ± 0.07 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0706 |
| Residual factor for significantly intense reflections |
0.0479 |
| Weighted residual factors for significantly intense reflections |
0.1113 |
| Weighted residual factors for all reflections included in the refinement |
0.1224 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243360.html