Information card for entry 2243614
| Chemical name |
(<i>E</i>)-3-[(4-Methylbenzylidene)amino]-5-phenylthiazolidin-2-iminium bromide <i>N</i>,<i>N</i>-dimethylformamide monosolvate |
| Formula |
C20 H25 Br N4 O S |
| Calculated formula |
C20 H25 Br N4 O S |
| SMILES |
[Br-].N(=C\c1ccc(cc1)C)/[N+]1CC(SC=1N)c1ccccc1.N(C=O)(C)C |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of (<i>E</i>)-3-[(4-methylbenzylidene)amino]-5-phenylthiazolidin-2-iminium bromide <i>N</i>,<i>N</i>-dimethylformamide monosolvate |
| Authors of publication |
Duruskari, Gulnara Sh.; Khalilov, Ali N.; Mammadova, Gunay Z.; Çelikesir, Sevim Türktekin; Akkurt, Mehmet; Akobirshoeva, Anzurat A.; Maharramov, Abel M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
10 |
| Pages of publication |
1694 - 1698 |
| a |
8.4326 ± 0.0006 Å |
| b |
31.778 ± 0.002 Å |
| c |
8.468 ± 0.0006 Å |
| α |
90° |
| β |
110.052 ± 0.002° |
| γ |
90° |
| Cell volume |
2131.6 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0678 |
| Residual factor for significantly intense reflections |
0.0382 |
| Weighted residual factors for significantly intense reflections |
0.0765 |
| Weighted residual factors for all reflections included in the refinement |
0.087 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243614.html