Information card for entry 2243625
| Common name |
Ammine[2,2'-(pyridine-2,6-diyl)bis(3,5-di-<i>p</i>-tolylpyrrolido-κ<i>N</i>)]nickel(II) |
| Chemical name |
Ammine{2,2'-(pyridine-2,6-diyl)bis[3,5-bis(4-methylphenyl)pyrrolido-κ<i>N</i>]}nickel(II) |
| Formula |
C41 H36 N4 Ni |
| Calculated formula |
C41 H36 N4 Ni |
| SMILES |
[Ni]12(n3c(cc(c3c3[n]1c(ccc3)c1n2c(cc1c1ccc(cc1)C)c1ccc(cc1)C)c1ccc(cc1)C)c1ccc(cc1)C)[NH3] |
| Title of publication |
Nickel(II) carbonyl, ammonia, and acetonitrile complexes supported by a pyridine dipyrrolide pincer ligand |
| Authors of publication |
Dias, H. V. Rasika; Pramanik, Abhijit |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
11 |
| Pages of publication |
1741 - 1747 |
| a |
15.9773 ± 0.0006 Å |
| b |
14.9441 ± 0.0005 Å |
| c |
14.3238 ± 0.0005 Å |
| α |
90° |
| β |
107.814 ± 0.0008° |
| γ |
90° |
| Cell volume |
3256.1 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100.01 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0444 |
| Residual factor for significantly intense reflections |
0.0356 |
| Weighted residual factors for significantly intense reflections |
0.0929 |
| Weighted residual factors for all reflections included in the refinement |
0.0981 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243625.html