Information card for entry 2243797
| Chemical name |
6-Amino-8-phenyl-1,3,4,8-tetrahydro-2<i>H</i>-pyrido[1,2-<i>a</i>]pyrimidine-\ 7,9-dicarbonitrile |
| Formula |
C16 H15 N5 |
| Calculated formula |
C16 H15 N5 |
| SMILES |
N1CCCN2C(=C(C(C(=C12)C#N)c1ccccc1)C#N)N |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of 6-amino-8-phenyl-1,3,4,8-tetrahydro-2<i>H</i>-pyrido[1,2-<i>a</i>]pyrimidine-7,9-dicarbonitrile |
| Authors of publication |
Naghiyev, Farid N.; Tereshina, Tatiana A.; Khrustalev, Victor N.; Akkurt, Mehmet; Khalilov, Ali N.; Akobirshoeva, Anzurat A.; Mamedov, İbrahim G. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
5 |
| Pages of publication |
512 - 515 |
| a |
8.2521 ± 0.0006 Å |
| b |
10.2774 ± 0.0008 Å |
| c |
16.2102 ± 0.0012 Å |
| α |
90° |
| β |
92.07 ± 0.002° |
| γ |
90° |
| Cell volume |
1373.89 ± 0.18 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1614 |
| Residual factor for significantly intense reflections |
0.066 |
| Weighted residual factors for significantly intense reflections |
0.1333 |
| Weighted residual factors for all reflections included in the refinement |
0.172 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243797.html