Information card for entry 2243986
| Chemical name |
2-{[(<i>E</i>)-(3-Cyclobutyl-1<i>H</i>-1,2,4-triazol-5-yl)imino]methyl}phenol |
| Formula |
C13 H14 N4 O |
| Calculated formula |
C13 H14 N4 O |
| SMILES |
[nH]1nc(/N=C/c2ccccc2O)nc1C1CCC1 |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of 2-{[(<i>E</i>)-(3-cyclobutyl-1<i>H</i>-1,2,4-triazol-5-yl)imino]methyl}phenol |
| Authors of publication |
Gumus, Mustafa Kemal; Sen, Fatih; Kansiz, Sevgi; Dege, Necmi; Saif, Eiad |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
12 |
| Pages of publication |
1267 - 1271 |
| a |
5.2717 ± 0.0003 Å |
| b |
24.9066 ± 0.0014 Å |
| c |
14.8628 ± 0.0007 Å |
| α |
90° |
| β |
96.214 ± 0.004° |
| γ |
90° |
| Cell volume |
1940.02 ± 0.18 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0866 |
| Residual factor for significantly intense reflections |
0.0577 |
| Weighted residual factors for significantly intense reflections |
0.1385 |
| Weighted residual factors for all reflections included in the refinement |
0.1532 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.935 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243986.html