Information card for entry 2243992
| Chemical name |
4,6-Dibromo-2,3,3-trimethyl-3<i>H</i>-indole |
| Formula |
C11 H11 Br2 N |
| Calculated formula |
C11 H11 Br2 N |
| SMILES |
Brc1cc2N=C(C(c2c(Br)c1)(C)C)C |
| Title of publication |
Crystal structures and Hirshfeld analysis of 4,6-dibromoindolenine and its quaternized salt |
| Authors of publication |
Konovalova, Irina S.; Shishkina, Svitlana V.; Kobzev, Dmytro; Semenova, Olha; Tatarets, Anatoliy |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
12 |
| Pages of publication |
1203 - 1207 |
| a |
8.7761 ± 0.0005 Å |
| b |
11.3876 ± 0.0007 Å |
| c |
11.8654 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1185.81 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0562 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for significantly intense reflections |
0.1103 |
| Weighted residual factors for all reflections included in the refinement |
0.1207 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.072 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243992.html