Information card for entry 2244061
| Chemical name |
5-(1<i>H</i>-Indol-3-yl)-2,1,3-benzoxadiazole |
| Formula |
C14 H9 N3 O |
| Calculated formula |
C14 H9 N3 O |
| SMILES |
o1nc2c(n1)cc(cc2)c1c[nH]c2c1cccc2 |
| Title of publication |
Structural study of bioisosteric derivatives of 5-(1<i>H</i>-indol-3-yl)-benzotriazole and their ability to form chalcogen bonds |
| Authors of publication |
Mirgaux, Manon; Scaillet, Tanguy; Kozlova, Arina; Tumanov, Nikolay; Frederick, Raphaël; Bodart, Laurie; Wouters, Johan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2022 |
| Journal volume |
78 |
| Journal issue |
4 |
| a |
12.0256 ± 0.0007 Å |
| b |
7.7396 ± 0.0005 Å |
| c |
23.8551 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2220.3 ± 0.2 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0829 |
| Residual factor for significantly intense reflections |
0.0497 |
| Weighted residual factors for significantly intense reflections |
0.1151 |
| Weighted residual factors for all reflections included in the refinement |
0.1337 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2244061.html