Information card for entry 2244105
| Chemical name |
2,4,6-Triaminopyrimidine-1,3-diium dinitrate |
| Formula |
C4 H9 N7 O6 |
| Calculated formula |
C4 H9 N7 O6 |
| SMILES |
O=N(=O)[O-].O=N(=O)[O-].[nH+]1c([nH+]c(N)cc1N)N |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of 2,4,6-triaminopyrimidine-1,3-diium dinitrate |
| Authors of publication |
Dilshad, Sumra; Çınar, Emine Berrin; Ali, Arif; Ahmed, Adeeba; Alam, Mohd Jane; Ahmad, Musheer; Ahmad, Aiman; Dege, Necmi; Saif, Eiad |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2022 |
| Journal volume |
78 |
| Journal issue |
6 |
| a |
7.865 ± 0.0005 Å |
| b |
9.9173 ± 0.0006 Å |
| c |
12.2291 ± 0.0007 Å |
| α |
90° |
| β |
100.836 ± 0.002° |
| γ |
90° |
| Cell volume |
936.86 ± 0.1 Å3 |
| Cell temperature |
276 ± 2 K |
| Ambient diffraction temperature |
276 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.046 |
| Residual factor for significantly intense reflections |
0.0399 |
| Weighted residual factors for significantly intense reflections |
0.1041 |
| Weighted residual factors for all reflections included in the refinement |
0.1099 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2244105.html