Information card for entry 2311914
| Chemical name |
ethyl (1R,2R,3S,5S)-3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| Formula |
C18 H23 N O4 |
| Calculated formula |
C18 H23 N O4 |
| SMILES |
O(CC)C(=O)[C@H]1[C@@H](OC(=O)c2ccccc2)C[C@H]2N(C)[C@@H]1CC2 |
| Title of publication |
Cocaethylene, the in vivo product of cocaine and ethanol, is a narcotic more potent than its precursors. |
| Authors of publication |
Maia, Angélica Faleiros da Silva; Martins, Felipe T.; Silva Neto, Leonardo da; Alves, Rosemeire Brondi; De Fátima, Ângelo |
| Journal of publication |
Acta crystallographica. Section C, Structural chemistry |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
Pt 10 |
| Pages of publication |
780 - 783 |
| a |
8.4533 ± 0.0002 Å |
| b |
10.238 ± 0.0003 Å |
| c |
10.2552 ± 0.0002 Å |
| α |
90° |
| β |
107.881 ± 0.001° |
| γ |
90° |
| Cell volume |
844.66 ± 0.04 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0374 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for all reflections included in the refinement |
0.1011 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2311914.html