Information card for entry 2311925
| Chemical name |
<i>N</i>-(2,3-Dichlorophenyl)-2,5-dimethoxybenzenesulfonamide |
| Formula |
C14 H13 Cl2 N O4 S |
| Calculated formula |
C14 H13 Cl2 N O4 S |
| SMILES |
c1(c(ccc(c1)OC)OC)S(=O)(=O)Nc1c(c(ccc1)Cl)Cl |
| Title of publication |
Different supramolecular architectures mediated by different weak interactions in the crystals of three N-aryl-2,5-dimethoxybenzenesulfonamides. |
| Authors of publication |
Shakuntala, K.; Naveen, S.; Lokanath, N. K.; Suchetan, P. A.; Abdoh, M. |
| Journal of publication |
Acta crystallographica. Section C, Structural chemistry |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
Pt 10 |
| Pages of publication |
833 - 844 |
| a |
9.7575 ± 0.0003 Å |
| b |
11.0792 ± 0.0003 Å |
| c |
15.5286 ± 0.0004 Å |
| α |
88.733 ± 0.001° |
| β |
83.753 ± 0.001° |
| γ |
66.337 ± 0.001° |
| Cell volume |
1528.02 ± 0.07 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0333 |
| Residual factor for significantly intense reflections |
0.0328 |
| Weighted residual factors for significantly intense reflections |
0.0903 |
| Weighted residual factors for all reflections included in the refinement |
0.0909 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2311925.html
