Information card for entry 4030026
| Formula |
C15 H7 N O3 |
| Calculated formula |
C15 H7 N O3 |
| SMILES |
O=c1c2c(C(=O)NC2=O)c2cccc3cccc1c23 |
| Title of publication |
1-Oxo-1H-phenalene-2,3-dicarbonitrile Heteroaromatic Scaffold: Revised Structure and Mechanistic Studies. |
| Authors of publication |
Lenk, Romaric; Tessier, Arnaud; Lefranc, Pierre; Silvestre, Virginie; Planchat, Aurélien; Blot, Virginie; Dubreuil, Didier; Lebreton, Jacques |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2014 |
| Journal volume |
79 |
| Journal issue |
20 |
| Pages of publication |
9754 - 9761 |
| a |
12.8326 ± 0.0002 Å |
| b |
5.3196 ± 0.0004 Å |
| c |
7.7207 ± 0.0006 Å |
| α |
90° |
| β |
90.073 ± 0.004° |
| γ |
90° |
| Cell volume |
527.05 ± 0.06 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1015 |
| Residual factor for significantly intense reflections |
0.0627 |
| Weighted residual factors for significantly intense reflections |
0.1216 |
| Weighted residual factors for all reflections included in the refinement |
0.1421 |
| Goodness-of-fit parameter for significantly intense reflections |
1.55 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.55 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4030026.html