Information card for entry 4032170
| Formula |
C19 H27 F6 N2 P |
| Calculated formula |
C19 H27 F6 N2 P |
| SMILES |
c1(c(C(C)C)cccc1C(C)C)n1cc[n+](c1)C1CCC1.[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Readily Accessible Unsymmetrical Unsaturated 2,6-Diisopropylphenyl N-Heterocyclic Carbene Ligands. Applications in Enantioselective Catalysis. |
| Authors of publication |
Tarrieu, Robert; Dumas, Adrien; Thongpaen, Jompol; Vives, Thomas; Roisnel, Thierry; Dorcet, Vincent; Crévisy, Christophe; Baslé, Olivier; Mauduit, Marc |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2017 |
| Journal volume |
82 |
| Journal issue |
4 |
| Pages of publication |
1880 - 1887 |
| a |
9.6418 ± 0.0005 Å |
| b |
13.0731 ± 0.0007 Å |
| c |
16.4088 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2068.3 ± 0.2 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0519 |
| Residual factor for significantly intense reflections |
0.0439 |
| Weighted residual factors for significantly intense reflections |
0.1079 |
| Weighted residual factors for all reflections included in the refinement |
0.1132 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4032170.html