Information card for entry 4032805
| Formula |
C10 H6 F3 N3 O2 |
| Calculated formula |
C10 H6 F3 N3 O2 |
| SMILES |
C(F)(F)(F)c1ccn(c2ccc(cc2)N(=O)=O)n1 |
| Title of publication |
Regioselective Synthesis, NMR, and Crystallographic Analysis of N1-Substituted Pyrazoles. |
| Authors of publication |
Huang, Adrian; Wo, Kellie; Lee, So Yeun Christine; Kneitschel, Nika; Chang, Jennifer; Zhu, Kathleen; Mello, Tatsiana; Bancroft, Laura; Norman, Natalie J.; Zheng, Shao-Liang |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2017 |
| Journal volume |
82 |
| Journal issue |
17 |
| Pages of publication |
8864 - 8872 |
| a |
7.8683 ± 0.0005 Å |
| b |
11.5556 ± 0.0008 Å |
| c |
11.5585 ± 0.0008 Å |
| α |
90° |
| β |
96.3412 ± 0.0011° |
| γ |
90° |
| Cell volume |
1044.5 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0441 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.0965 |
| Weighted residual factors for all reflections included in the refinement |
0.1021 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4032805.html