Information card for entry 4034387
| Formula |
C14 H6 Br4 |
| Calculated formula |
C14 H6 Br4 |
| SMILES |
Brc1cc2c(cc1Br)cc1cc(Br)c(Br)cc1c2 |
| Title of publication |
2,3-Dihalo- and 2,3,6,7-Tetrahaloanthracenes by Vollhardt Trimerization. |
| Authors of publication |
Hoffmann, Hendrik; Mukanov, Diana; Ganschow, Michael; Rominger, Frank; Freudenberg, Jan; Bunz, Uwe H. F. |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2019 |
| Journal volume |
84 |
| Journal issue |
15 |
| Pages of publication |
9826 - 9834 |
| a |
6.3875 ± 0.0005 Å |
| b |
15.891 ± 0.0013 Å |
| c |
6.5698 ± 0.0005 Å |
| α |
90° |
| β |
100.771 ± 0.0011° |
| γ |
90° |
| Cell volume |
655.11 ± 0.09 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0229 |
| Residual factor for significantly intense reflections |
0.0193 |
| Weighted residual factors for significantly intense reflections |
0.0451 |
| Weighted residual factors for all reflections included in the refinement |
0.0462 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4034387.html