Information card for entry 4035248
| Formula |
C16 H14 B F2 N3 O S |
| Calculated formula |
C16 H14 B F2 N3 O S |
| SMILES |
CN(C)c1ccc(cc1)C1=Nc2[n](c3c(cccc3)s2)[B](O1)(F)F |
| Title of publication |
Benzo[4,5]thiazolo[3,2- c][1,3,5,2]oxadiazaborinines: Synthesis, Structural, and Photophysical Properties. |
| Authors of publication |
Potopnyk, Mykhaylo A.; Volyniuk, Dmytro; Ceborska, Magdalena; Cmoch, Piotr; Hladka, Iryna; Danyliv, Yan; Gražulevičius, Juozas Vidas |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2018 |
| Journal volume |
83 |
| Journal issue |
19 |
| Pages of publication |
12129 - 12142 |
| a |
17.2717 ± 0.0008 Å |
| b |
10.711 ± 0.0005 Å |
| c |
8.2114 ± 0.0005 Å |
| α |
90° |
| β |
96.983 ± 0.004° |
| γ |
90° |
| Cell volume |
1507.82 ± 0.14 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1283 |
| Residual factor for significantly intense reflections |
0.1052 |
| Weighted residual factors for significantly intense reflections |
0.2943 |
| Weighted residual factors for all reflections included in the refinement |
0.3059 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.27 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4035248.html