Information card for entry 4035764
| Formula |
C23 H24 N6 O2 |
| Calculated formula |
C23 H24 N6 O2 |
| SMILES |
O1Cc2nnn(c2c2n(nnc2COCCC1)Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
Medium Rings Bearing Bitriazolyls: Easily Accessible Structures with Superior Performance as Cu Catalyst Ligands. |
| Authors of publication |
Li, Lingjun; Huang, Shenlong; Shang, Tongpeng; Zhang, Bo; Guo, Yuanyang; Zhu, Gongming; Zhou, Demin; Zhang, Guisheng; Zhu, Anlian; Zhang, Lihe |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2018 |
| Journal volume |
83 |
| Journal issue |
21 |
| Pages of publication |
13166 - 13177 |
| a |
8.2396 ± 0.0002 Å |
| b |
11.5901 ± 0.0005 Å |
| c |
12.2867 ± 0.0006 Å |
| α |
107.523 ± 0.004° |
| β |
104.775 ± 0.003° |
| γ |
90.14 ± 0.003° |
| Cell volume |
1077.91 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0738 |
| Residual factor for significantly intense reflections |
0.0549 |
| Weighted residual factors for significantly intense reflections |
0.1661 |
| Weighted residual factors for all reflections included in the refinement |
0.174 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.178 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4035764.html
