Information card for entry 4036683
| Formula |
C13 H14 F4 O4 |
| Calculated formula |
C13 H14 F4 O4 |
| SMILES |
FC1(F)C(O)(O)COC(C1(F)F)COCc1ccccc1 |
| Title of publication |
Enantioselective Synthesis of Dideoxy-tetrafluorinated Hexoses. |
| Authors of publication |
Golten, Samuel; Fontenelle, Clément Q; Timofte, Roxana S.; Bailac, Laura; Light, Mark; Sebban, Muriel; Oulyadi, Hassan; Linclau, Bruno |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2016 |
| Journal volume |
81 |
| Journal issue |
11 |
| Pages of publication |
4434 - 4453 |
| a |
8.8199 ± 0.0003 Å |
| b |
5.5422 ± 0.0002 Å |
| c |
28.043 ± 0.0007 Å |
| α |
90° |
| β |
91.413 ± 0.002° |
| γ |
90° |
| Cell volume |
1370.37 ± 0.08 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0506 |
| Residual factor for significantly intense reflections |
0.0471 |
| Weighted residual factors for significantly intense reflections |
0.1156 |
| Weighted residual factors for all reflections included in the refinement |
0.118 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.13 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Diffraction radiation X-ray symbol |
K-L~2,3~ |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4036683.html
