Information card for entry 4037152
| Formula |
C21 H24 N2 O |
| Calculated formula |
C21 H24 N2 O |
| SMILES |
C1(=O)C[C@@H]2CCC[C@@](C)(c3ccccc3)N2N1Cc1ccccc1.C1(=O)C[C@H]2CCC[C@](C)(c3ccccc3)N2N1Cc1ccccc1 |
| Title of publication |
Synthesis of 3D-Rich Heterocycles: Hexahydropyrazolo[1,5-a]pyridin-2(1H)-ones and Octahydro-2H-2a,2a<sup>1</sup>-diazacyclopenta[cd]inden-2-ones. |
| Authors of publication |
Pušavec Kirar, Eva; Drev, Miha; Mirnik, Jona; Grošelj, Uroš; Golobič, Amalija; Dahmann, Georg; Požgan, Franc; Štefane, Bogdan; Svete, Jurij |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2016 |
| Journal volume |
81 |
| Journal issue |
19 |
| Pages of publication |
8920 - 8933 |
| a |
14.2317 ± 0.0008 Å |
| b |
8.1922 ± 0.0004 Å |
| c |
15.0607 ± 0.0007 Å |
| α |
90° |
| β |
94.054 ± 0.004° |
| γ |
90° |
| Cell volume |
1751.52 ± 0.15 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0763 |
| Residual factor for significantly intense reflections |
0.0513 |
| Weighted residual factors for significantly intense reflections |
0.1209 |
| Weighted residual factors for all reflections included in the refinement |
0.1371 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4037152.html