Information card for entry 4037882
| Formula |
C33 H32 N2 O5 S2 |
| Calculated formula |
C33 H32 N2 O5 S2 |
| SMILES |
S(=O)(=O)(N1c2ccccc2C[C@@H]2O[C@H]3N(S(=O)(=O)c4ccc(cc4)C)c4c(C[C@H]3[C@H]12)cc(cc4)C)c1ccc(cc1)C.S(=O)(=O)(N1c2ccccc2C[C@H]2O[C@@H]3N(S(=O)(=O)c4ccc(cc4)C)c4c(C[C@@H]3[C@@H]12)cc(cc4)C)c1ccc(cc1)C |
| Title of publication |
Synthesis of Furo[3,2-b]quinolines and Furo[2,3-b:4,5-b']diquinolines through [4+2] Cycloaddition of Aza-o-Quinone Methides and Furans. |
| Authors of publication |
Lei, Lu; Yao, Yi-Yun; Jiang, Li-Juan; Lu, Xiuqiang; Liang, Cui; Mo, Dong-Liang |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
9.9394 ± 0.0009 Å |
| b |
11.9322 ± 0.001 Å |
| c |
13.6398 ± 0.0006 Å |
| α |
70.892 ± 0.006° |
| β |
77.159 ± 0.007° |
| γ |
86.585 ± 0.007° |
| Cell volume |
1490.2 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1327 |
| Residual factor for significantly intense reflections |
0.0634 |
| Weighted residual factors for significantly intense reflections |
0.1207 |
| Weighted residual factors for all reflections included in the refinement |
0.1688 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4037882.html