Information card for entry 4037906
| Chemical name |
N-(4-isobutyl-2,5-dioxopiperazin-1-yl)benzamide |
| Formula |
C15 H19 N3 O3 |
| Calculated formula |
C15 H19 N3 O3 |
| SMILES |
O=C1N(CC(=O)N(NC(=O)c2ccccc2)C1)CC(C)C |
| Title of publication |
Solid-phase Synthesis of Hybrid 2,5-Diketopiperazines Using Acylhydrazide, Carbazate, Semicarbazide, Amino Acid and Primary Amine Submonomers. |
| Authors of publication |
Rahim, Abdur; Sahariah, Biswajit; Baruah, Kalpita; Deka, Jugal Kishore Rai; Sarma, Bani Kanta |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
5.9113 ± 0.0004 Å |
| b |
8.836 ± 0.0005 Å |
| c |
30.1022 ± 0.0019 Å |
| α |
90° |
| β |
91.803 ± 0.002° |
| γ |
90° |
| Cell volume |
1571.53 ± 0.17 Å3 |
| Cell temperature |
297 ± 2 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1427 |
| Residual factor for significantly intense reflections |
0.0548 |
| Weighted residual factors for significantly intense reflections |
0.1444 |
| Weighted residual factors for all reflections included in the refinement |
0.2031 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.008 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4037906.html