Information card for entry 4038286
| Formula |
C13 H14 B F2 N3 O S |
| Calculated formula |
C13 H14 B F2 N3 O S |
| SMILES |
CN(C)c1ccc(cc1)C1=Nc2[n](cc(C)s2)[B](O1)(F)F |
| Title of publication |
Organolithium-Mediated Postfunctionalization of Thiazolo[3,2-<i>c</i>][1,3,5,2]oxadiazaborinine Fluorescent Dyes. |
| Authors of publication |
Potopnyk, Mykhaylo A.; Volyniuk, Dmytro; Luboradzki, Roman; Ceborska, Magdalena; Hladka, Iryna; Danyliv, Yan; Grazulevicius, Juozas V. |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| Journal volume |
85 |
| Journal issue |
9 |
| Pages of publication |
6060 - 6072 |
| a |
15.5882 ± 0.0002 Å |
| b |
11.6785 ± 0.0002 Å |
| c |
7.5331 ± 0.0001 Å |
| α |
90° |
| β |
94.724 ± 0.001° |
| γ |
90° |
| Cell volume |
1366.72 ± 0.03 Å3 |
| Cell temperature |
100.01 ± 0.1 K |
| Ambient diffraction temperature |
100.01 ± 0.1 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.031 |
| Residual factor for significantly intense reflections |
0.0302 |
| Weighted residual factors for significantly intense reflections |
0.0847 |
| Weighted residual factors for all reflections included in the refinement |
0.0855 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038286.html