Information card for entry 4038467
| Formula |
C12 H11 N O2 |
| Calculated formula |
C12 H11 N O2 |
| SMILES |
[nH]1ccc(C(=O)OC)c1c1ccccc1 |
| Title of publication |
IBX-Promoted Oxidative Cyclization of N-Hydroxyalkyl Enamines: A Metal-free Approach towards 2,3-Disubstituted Pyrroles and Pyridines. |
| Authors of publication |
Gao, Peng; Chen, Huai-Juan; Bai, Zi-Jing; Zhao, Mi-Na; Yang, Desuo; Wang, Juan; Wang, Ning; Du, Lele; Guan, Zheng-Hui |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
12.858 ± 0.003 Å |
| b |
9.1867 ± 0.0018 Å |
| c |
18.757 ± 0.004 Å |
| α |
90° |
| β |
104.697 ± 0.003° |
| γ |
90° |
| Cell volume |
2143.1 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0577 |
| Residual factor for significantly intense reflections |
0.0438 |
| Weighted residual factors for significantly intense reflections |
0.1123 |
| Weighted residual factors for all reflections included in the refinement |
0.1223 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038467.html