Information card for entry 4038553
| Formula |
C15 H11 N O4 |
| Calculated formula |
C15 H11 N O4 |
| SMILES |
O=C1c2c(C3=CC(=O)N(C3=O)CC)cccc2OC=C1 |
| Title of publication |
Ruthenium(II)-catalyzed C-H activation of chromones with maleimides to synthesize succinimide/ maleimide-containing chromones. |
| Authors of publication |
Zhou, Yan; Liang, Hong; Sheng, Yaoguang; Wang, Shaoli; Gao, Yi; Zhan, Lingling; Zheng, Zhilong; Yang, Mengjie; Liang, Guang; Zhou, Jianmin; Deng, Jun; Song, Zengqiang |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
10.8933 ± 0.0005 Å |
| b |
11.5767 ± 0.0005 Å |
| c |
11.8325 ± 0.0006 Å |
| α |
76.19 ± 0.004° |
| β |
70.082 ± 0.004° |
| γ |
67.095 ± 0.004° |
| Cell volume |
1282.56 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0894 |
| Residual factor for significantly intense reflections |
0.0583 |
| Weighted residual factors for significantly intense reflections |
0.1274 |
| Weighted residual factors for all reflections included in the refinement |
0.1505 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038553.html
