Information card for entry 4038745
| Formula |
C29 H28 Br N O4 |
| Calculated formula |
C29 H28 Br N O4 |
| SMILES |
Brc1ccc2c3C(NCCC)(c4c(OC)cccc4OC)c4c(Oc3ccc2c1)cccc4OC |
| Title of publication |
Synthesis, Resolution, Configurational Stability, and Properties of Cationic Functionalized [5]Helicenes. |
| Authors of publication |
Marinova, Maya; Pascal, Simon; Guénée, Laure; Besnard, Céline; Shivachev, Boris; Kostova, Kalina; Villani, Claudio; Franzini, Roberta; Dimitrov, Vladimir; Lacour, Jérôme |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| Journal volume |
85 |
| Journal issue |
18 |
| Pages of publication |
11908 - 11923 |
| a |
8.9485 ± 0.0003 Å |
| b |
21.3763 ± 0.0005 Å |
| c |
13.2147 ± 0.0003 Å |
| α |
90° |
| β |
99.059 ± 0.003° |
| γ |
90° |
| Cell volume |
2496.25 ± 0.12 Å3 |
| Cell temperature |
290 K |
| Ambient diffraction temperature |
290 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0845 |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for significantly intense reflections |
0.1038 |
| Weighted residual factors for all reflections included in the refinement |
0.1185 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038745.html