Information card for entry 4062607
| Formula |
C16 H28 O2 Si4 |
| Calculated formula |
C16 H28 O2 Si4 |
| SMILES |
C1(=O)C2=C(C(=O)C3=C1[Si](C[Si]3(C)C)(C)C)[Si](C[Si]2(C)C)(C)C |
| Title of publication |
2,3,5,6-Tetrasilyl- and 2,3,5,6-tetragermyl-1,4-benzoquinones: X-ray Crystallographic Analysis and DFT Calculations |
| Authors of publication |
Tsutsui, Shinobu; Sakamoto, Kenkichi |
| Journal of publication |
Organometallics |
| Year of publication |
2004 |
| a |
9.297 ± 0.0019 Å |
| b |
11.214 ± 0.002 Å |
| c |
19.78 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2062.2 ± 0.7 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4062607.html