Information card for entry 4064675
| Formula |
C44 H28 F2 Ge |
| Calculated formula |
C44 H28 F2 Ge |
| SMILES |
[Ge]1(C(=C(C(=C1c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)(C#Cc1cc(F)ccc1)C#Cc1cccc(c1)F |
| Title of publication |
Synthesis, Characterization, and Crystal Structures of 1,1-Disubstituted-2,3,4,5-tetraphenylgermoles That Exhibit Aggregation-Induced Emission |
| Authors of publication |
Bandrowsky, Teresa L.; Carroll, James B.; Braddock-Wilking, Janet |
| Journal of publication |
Organometallics |
| Year of publication |
2011 |
| Journal volume |
30 |
| Journal issue |
13 |
| Pages of publication |
3559 |
| a |
10.555 ± 0.002 Å |
| b |
11.095 ± 0.002 Å |
| c |
15.68 ± 0.003 Å |
| α |
92.23 ± 0.03° |
| β |
104.77 ± 0.03° |
| γ |
113.52 ± 0.03° |
| Cell volume |
1607.4 ± 0.7 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0477 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for all reflections |
0.1121 |
| Weighted residual factors for significantly intense reflections |
0.1092 |
| Weighted residual factors for all reflections included in the refinement |
0.1121 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.98 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4064675.html