Information card for entry 4072619
| Chemical name |
1,2,2,5,5-Pentamethyl-4-diphenylphosphinoyl-2,5-dihydro-1H- imidazole-3-oxide |
| Formula |
C20 H25 N2 O2 P |
| Calculated formula |
C20 H25 N2 O2 P |
| SMILES |
P(=O)(C1=N(=O)C(N(C1(C)C)C)(C)C)(c1ccccc1)c1ccccc1 |
| Title of publication |
α-Organoelement Nitrones: Synthesis, Properties, and IR and13C NMR Spectral and X-ray Structural Characterization† |
| Authors of publication |
Voinov, Maxim A.; Shevelev, Tikhon G.; Rybalova, Tatyana V.; Gatilov, Yury V.; Pervukhina, Natalie V.; Burdukov, Aleksei B.; Grigor'ev, Igor A. |
| Journal of publication |
Organometallics |
| Year of publication |
2007 |
| Journal volume |
26 |
| Journal issue |
7 |
| Pages of publication |
1607 |
| a |
12.4029 ± 0.0008 Å |
| b |
8.9187 ± 0.0005 Å |
| c |
17.7928 ± 0.0012 Å |
| α |
90° |
| β |
90.994 ± 0.006° |
| γ |
90° |
| Cell volume |
1967.9 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.065 |
| Residual factor for significantly intense reflections |
0.0456 |
| Weighted residual factors for significantly intense reflections |
0.1104 |
| Weighted residual factors for all reflections included in the refinement |
0.123 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4072619.html