Information card for entry 4074664
| Formula |
C24 H30 B Ge Na |
| Calculated formula |
C24 H30 B Ge Na |
| SMILES |
[Ge](CC)(CC)(CC)[B](c1ccccc1)(c1ccccc1)c1ccccc1.[Na+] |
| Title of publication |
Preparation, Structural Characterization, and Photochemical Reactions of Silyl- and Germylborates |
| Authors of publication |
Nanjo, Masato; Matsudo, Kazuhiko; Kurihara, Mari; Nakamura, Sayaka; Sakaguchi, Yoshio; Hayashi, Hisaharu; Mochida, Kunio |
| Journal of publication |
Organometallics |
| Year of publication |
2006 |
| Journal volume |
25 |
| Journal issue |
4 |
| Pages of publication |
832 |
| a |
12.497 ± 0.0005 Å |
| b |
11.675 ± 0.0006 Å |
| c |
15.574 ± 0.0006 Å |
| α |
90° |
| β |
102.449 ± 0.003° |
| γ |
90° |
| Cell volume |
2218.86 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0307 |
| Residual factor for significantly intense reflections |
0.0298 |
| Weighted residual factors for significantly intense reflections |
0.1107 |
| Weighted residual factors for all reflections included in the refinement |
0.1128 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4074664.html