Information card for entry 4074997
| Formula |
C32 H32 B N3 O4 |
| Calculated formula |
C32 H32 B N3 O4 |
| SMILES |
O1[B]([N](=C(C(=C1C)N=Nc1ccc(OC)cc1)C)c1c(OC)cc(OC)cc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
Novel 5-(4-Substituted-phenyldiazenyl)-1,3,2λ4-oxazaborines and Their Rearrangement to 1,2,4,3λ4-Triazaborines |
| Authors of publication |
Pešková, Markéta; Šimůnek, Petr; Bertolasi, Valerio; Macháček, Vladimír; Lyčka, Antonín |
| Journal of publication |
Organometallics |
| Year of publication |
2006 |
| Journal volume |
25 |
| Journal issue |
8 |
| Pages of publication |
2025 |
| a |
12.9055 ± 0.0003 Å |
| b |
11.8869 ± 0.0003 Å |
| c |
19.0398 ± 0.0004 Å |
| α |
90° |
| β |
97.205 ± 0.002° |
| γ |
90° |
| Cell volume |
2897.76 ± 0.12 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0947 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1297 |
| Weighted residual factors for all reflections included in the refinement |
0.155 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4074997.html