Information card for entry 4075380
| Formula |
C38 H38 O3 Ti |
| Calculated formula |
C38 H38 O3 Ti |
| SMILES |
[Ti]1234(OC(C)C)(OC(C)C)(OC(C)C)[c]56c7ccccc7c7ccccc7[c]46[cH]3[c]32[c]15c1ccccc1c1ccccc31 |
| Title of publication |
Tetrabenzo[a,c,g,i]fluorenyllithium and η5-Tetrabenzo[a,c,g,i]fluorenyltitanium Complexes |
| Authors of publication |
Schröder, Kai; Haase, Detlev; Saak, Wolfgang; Lützen, Arne; Beckhaus, Rüdiger; Wichmann, Silke; Schellenberg, Jürgen |
| Journal of publication |
Organometallics |
| Year of publication |
2006 |
| Journal volume |
25 |
| Journal issue |
16 |
| Pages of publication |
3824 |
| a |
16.4719 ± 0.0008 Å |
| b |
17.0792 ± 0.0007 Å |
| c |
22.1152 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
6221.6 ± 0.6 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0779 |
| Residual factor for significantly intense reflections |
0.0472 |
| Weighted residual factors for significantly intense reflections |
0.1193 |
| Weighted residual factors for all reflections included in the refinement |
0.1306 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.952 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4075380.html