Information card for entry 4078492
| Formula |
C41 H40 Cl2 P4 Pd |
| Calculated formula |
C41 H40 Cl2 P4 Pd |
| SMILES |
[Pd]1(Cl)(Cl)[P](CP(c2ccccc2)c2ccccc2)(CCC[P]1(CP(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
Cyclic Trinuclear Rh2M Complexes (M = Rh, Pt, Pd, Ni) Supported bymeso-1,3-Bis[(diphenylphosphinomethyl)phenylphosphino]propane |
| Authors of publication |
Nakajima, Takayuki; Kurai, Sachi; Noda, Sayo; Zouda, Maki; Kure, Bunsho; Tanase, Tomoaki |
| Journal of publication |
Organometallics |
| Year of publication |
2012 |
| Journal volume |
31 |
| Journal issue |
11 |
| Pages of publication |
4283 |
| a |
12.9431 ± 0.0006 Å |
| b |
12.9473 ± 0.0001 Å |
| c |
14.0177 ± 0.0004 Å |
| α |
79.24 ± 0.015° |
| β |
70.22 ± 0.011° |
| γ |
60.124 ± 0.011° |
| Cell volume |
1916.2 ± 0.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0284 |
| Weighted residual factors for all reflections included in the refinement |
0.0734 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.948 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4078492.html
