Information card for entry 4079591
| Formula |
C24.5 H13.5 Cl4.5 N7 O3 Re |
| Calculated formula |
C24.5 H13.5 Cl4.5 N7 O3 Re |
| SMILES |
[Re]1([n]2c3c(ccc2)ccc2c3[n]1ccc2)(C#[O])(C#[O])(C#[O])n1nc(nn1)c1ccc(cc1)C#N.C(Cl)(Cl)Cl.ClC(Cl)Cl |
| Title of publication |
Synthesis, Photophysical and Electrochemical Investigation of Dinuclear Tetrazolato-Bridged Rhenium Complexes |
| Authors of publication |
Wright, Phillip J.; Muzzioli, Sara; Werrett, Melissa V.; Raiteri, Paolo; Skelton, Brian W.; Silvester, Debbie S.; Stagni, Stefano; Massi, Massimiliano |
| Journal of publication |
Organometallics |
| Year of publication |
2012 |
| Journal volume |
31 |
| Journal issue |
21 |
| Pages of publication |
7566 |
| a |
12.5208 ± 0.0002 Å |
| b |
18.2828 ± 0.0003 Å |
| c |
24.9107 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5702.44 ± 0.17 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0628 |
| Residual factor for significantly intense reflections |
0.0437 |
| Weighted residual factors for significantly intense reflections |
0.0966 |
| Weighted residual factors for all reflections included in the refinement |
0.1026 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4079591.html