Information card for entry 4080834
| Formula |
C53 H62 B O5 P |
| Calculated formula |
C53 H62 B O5 P |
| SMILES |
c1(ccccc1OC)[P@](c1ccccc1)(c1cc2c(c(c1)Cc1c(c(ccc1)Cc1c(c(ccc1)Cc1c(c(ccc1)C2)OCCC)OCCC)OCCC)OCCC)[BH3] |
| Title of publication |
P-Chirogenic Phosphines Supported by Calix[4]arene: New Insight into Palladium-Catalyzed Asymmetric Allylic Substitution |
| Authors of publication |
Khiri-Meribout, Naima; Bertrand, Etienne; Bayardon, Jérôme; Eymin, Marie-Joëlle; Rousselin, Yoann; Cattey, Hélène; Fortin, Daniel; Harvey, Pierre D.; Jugé, Sylvain |
| Journal of publication |
Organometallics |
| Year of publication |
2013 |
| Journal volume |
32 |
| Journal issue |
9 |
| Pages of publication |
2827 |
| a |
15.5827 ± 0.0004 Å |
| b |
15.7535 ± 0.0004 Å |
| c |
18.4561 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4530.6 ± 0.2 Å3 |
| Cell temperature |
115 ± 2 K |
| Ambient diffraction temperature |
115 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1162 |
| Residual factor for significantly intense reflections |
0.0586 |
| Weighted residual factors for significantly intense reflections |
0.1186 |
| Weighted residual factors for all reflections included in the refinement |
0.1389 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4080834.html