Information card for entry 4085305
| Formula |
C37 H58 K N O4 |
| Calculated formula |
C37 H58 K N O4 |
| SMILES |
[K]([O]1CCCC1)([O]1CCCC1)[O]1CCCC1.[O-]c1c(/C=N/c2c(C(C)(C)C)cccc2)cc(cc1C(C)(C)C)C(C)(C)C |
| Title of publication |
Metal and Ligand-Substituent Effects in the Immortal Polymerization ofrac-Lactide with Li, Na, and K Phenoxo-imine Complexes |
| Authors of publication |
García-Valle, Francisco M.; Estivill, Robert; Gallegos, Carlos; Cuenca, Tomás; Mosquera, Marta E. G.; Tabernero, Vanessa; Cano, Jesús |
| Journal of publication |
Organometallics |
| Year of publication |
2015 |
| Journal volume |
34 |
| Journal issue |
2 |
| Pages of publication |
477 |
| a |
11.372 ± 0.006 Å |
| b |
17.158 ± 0.01 Å |
| c |
20.651 ± 0.002 Å |
| α |
78.495 ± 0.015° |
| β |
83.256 ± 0.017° |
| γ |
72.24 ± 0.03° |
| Cell volume |
3753 ± 3 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1456 |
| Residual factor for significantly intense reflections |
0.0744 |
| Weighted residual factors for significantly intense reflections |
0.1791 |
| Weighted residual factors for all reflections included in the refinement |
0.2119 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4085305.html