Information card for entry 4087141
| Formula |
C25 H29 B N P |
| Calculated formula |
C25 H29 B N P |
| SMILES |
[P](N1c2ccccc2C(=Cc2ccccc12)c1ccccc1)([BH3])(C(C)(C)C)C |
| Title of publication |
Developing P-Stereogenic, Planar–Chiral P-Alkene Ligands: Monodentate, Bidentate, and Double Agostic Coordination Modes on Ru(II) |
| Authors of publication |
Herrera, Alberto; Grasruck, Alexander; Heinemann, Frank W.; Scheurer, Andreas; Chelouan, Ahmed; Frieß, Sibylle; Seidel, Falk; Dorta, Romano |
| Journal of publication |
Organometallics |
| Year of publication |
2017 |
| Journal volume |
36 |
| Journal issue |
3 |
| Pages of publication |
714 |
| a |
7.8586 ± 0.0007 Å |
| b |
11.9229 ± 0.0009 Å |
| c |
12.133 ± 0.0016 Å |
| α |
78.522 ± 0.009° |
| β |
78.721 ± 0.006° |
| γ |
78.902 ± 0.005° |
| Cell volume |
1078.54 ± 0.19 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100.15 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0482 |
| Residual factor for significantly intense reflections |
0.0384 |
| Weighted residual factors for significantly intense reflections |
0.0962 |
| Weighted residual factors for all reflections included in the refinement |
0.1032 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4087141.html