Information card for entry 4108425
| Chemical name |
2,3,5,6,2',3',5'6'-ocatabromo-4,4'-dihexylbiphenyl |
| Formula |
C24 H26 Br8 |
| Calculated formula |
C24 H26 Br8 |
| SMILES |
Brc1c(c(Br)c(Br)c(c1Br)CCCCCC)c1c(Br)c(Br)c(c(Br)c1Br)CCCCCC |
| Title of publication |
18,18'-Dihexyl[9,9']biphenanthro[9,10-b]triphenylene: Construction and Consequences of a Profoundly Hindered Aryl-Aryl Single Bond |
| Authors of publication |
Cameron L. Hilton; Jeremy M. Crowfoot; Pawel Rempala; Benjamin T. King |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2008 |
| Journal volume |
130 |
| Pages of publication |
13392 - 13399 |
| a |
13.3087 ± 0.0004 Å |
| b |
17.4037 ± 0.0005 Å |
| c |
24.3214 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5633.3 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0666 |
| Residual factor for significantly intense reflections |
0.0362 |
| Weighted residual factors for significantly intense reflections |
0.0677 |
| Weighted residual factors for all reflections included in the refinement |
0.0727 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4108425.html