Information card for entry 4126256
| Formula |
C19 H27 F12 Fe N8 P2 |
| Calculated formula |
C19 H27 F12 Fe N8 P2 |
| SMILES |
[Fe]1234([n]5ccccc5C[N]51CC[N]2(CC[N]3(C)CC5)Cc1[n]4cccc1)N=N#N.[P](F)(F)(F)(F)(F)[F-].[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Generation, spectroscopic and chemical characterization of an octahedral iron (V) - nitrido species with a neutral ligand platform. |
| Authors of publication |
Sabenya, Gerard; Lazaro, Laura; Gamba, Ilaria; Martin-Diaconescu, Vlad; Andris, Erik; Weyhermüller, Thomas; Neese, Frank; Roithova, Jana; Bill, Eckhard; Lloret-Fillol, Julio; Costas, Miquel |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2017 |
| a |
11.312 ± 0.006 Å |
| b |
10.407 ± 0.005 Å |
| c |
22.323 ± 0.011 Å |
| α |
90° |
| β |
91.837 ± 0.009° |
| γ |
90° |
| Cell volume |
2627 ± 2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1589 |
| Residual factor for significantly intense reflections |
0.0692 |
| Weighted residual factors for significantly intense reflections |
0.1558 |
| Weighted residual factors for all reflections included in the refinement |
0.1961 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.949 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4126256.html