Information card for entry 4128272
| Formula |
C12 H14 O2 |
| Calculated formula |
C12 H14 O2 |
| SMILES |
O(c1cccc2CC(C(=O)c12)(C)C)C |
| Title of publication |
Sulfur-Based Intramolecular Hydrogen-Bond: Excited-State Hydrogen-Bond On/Off Switch with Dual Room-Temperature Phosphorescence. |
| Authors of publication |
Liu, Zong-Ying; Hu, Jiun-Wei; Huang, Chun-Hao; Huang, Teng-Hsing; Chen, Deng-Gao; Ho, Ssu-Yu; Chen, Kew-Yu; Li, Elise Y.; Chou, Pi-Tai |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2019 |
| Journal volume |
141 |
| Journal issue |
25 |
| Pages of publication |
9885 - 9894 |
| a |
25.4036 ± 0.0013 Å |
| b |
8.6525 ± 0.0004 Å |
| c |
9.0953 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1999.19 ± 0.16 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0541 |
| Residual factor for significantly intense reflections |
0.0437 |
| Weighted residual factors for significantly intense reflections |
0.1035 |
| Weighted residual factors for all reflections included in the refinement |
0.1098 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4128272.html