Information card for entry 4134055
| Chemical name |
2-((5'-(tert-butyl)-4,4"-dimethoxy-[1,1':3',1"-terphenyl]-4'-yl)amino)naphthalene-1,4-dione |
| Formula |
C35 H32 Cl3 N O4 |
| Calculated formula |
C35 H32 Cl3 N O4 |
| SMILES |
ClC(Cl)Cl.O(c1ccc(c2cc(c(NC3=CC(=O)c4c(C3=O)cccc4)c(c3ccc(OC)cc3)c2)C(C)(C)C)cc1)C |
| Title of publication |
Catalytic Atroposelective Synthesis of N-Aryl Quinoid Compounds. |
| Authors of publication |
Vaidya, Sagar Dilip; Toenjes, Sean T.; Yamamoto, Nobuyuki; Maddox, Sean M.; Gustafson, Jeffrey L. |
| Journal of publication |
Journal of the American Chemical Society |
| Year of publication |
2020 |
| a |
10.8613 ± 0.0018 Å |
| b |
13.099 ± 0.002 Å |
| c |
21.74 ± 0.004 Å |
| α |
90° |
| β |
99.381 ± 0.003° |
| γ |
90° |
| Cell volume |
3051.6 ± 0.9 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0306 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0784 |
| Weighted residual factors for all reflections included in the refinement |
0.0798 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4134055.html