Information card for entry 4300668
| Formula |
C30 H44 Cl In N2 |
| Calculated formula |
C30 H44 Cl In N2 |
| SMILES |
[In]1(Cl)([N](=C(C=C(N1c1c(cccc1C(C)C)C(C)C)C)C)c1c(cccc1C(C)C)C(C)C)C |
| Authors of publication |
Singh, Sanjay; Ahn, Hans-Jürgen; Stasch, Andreas; Jancik, Vojtech; Roesky, Herbert W.; Pal, Aritra; Biadene, Mariana; Herbst-Irmer, Regine; Noltemeyer, Mathias; Schmidt, Hans-Georg |
| Journal of publication |
Inorganic Chemistry |
| Year of publication |
2006 |
| a |
12.789 ± 0.002 Å |
| b |
19.631 ± 0.003 Å |
| c |
13.294 ± 0.002 Å |
| α |
90° |
| β |
117.53 ± 0.02° |
| γ |
90° |
| Cell volume |
2960 ± 1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4300668.html